C32H34ClNO8 — CID 163928618
3-[3-[(E)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]carbonyl-3-hydroxypentanedioic acid (PubChem CID 163928618) has the molecular formula C32H34ClNO8 and a molecular weight of 596.08 g/mol. Its IUPAC name is 3-[3-[(E)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]carbonyl-3-hydroxypentanedioic acid.
| Compound Name | 3-[3-[(E)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]carbonyl-3-hydroxypentanedioic acid |
|---|---|
| PubChem CID | 163928618 |
| Molecular Formula | C32H34ClNO8 |
| Molecular Weight | 596.08 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 3-[3-[(E)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]carbonyl-3-hydroxypentanedioic acid |
| SMILES | CCN(CC)CCOc1ccc(/C(=C(\Cl)c2ccccc2)c2cccc(OC(=O)C(O)(CC(=O)O)CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C32H34ClNO8/c1-3-34(4-2)17-18-41-25-15-13-22(14-16-25)29(30(33)23-9-6-5-7-10-23)24-11-8-12-26(19-24)42-31(39)32(40,20-27(35)36)21-28(37)38/h5-16,19,40H,3-4,17-18,20-21H2,1-2H3,(H,35,36)(H,37,38)/b30-29+ |
| InChIKey | RGSAUORHLZODEO-QVIHXGFCSA-N |
| XLogP | 5.15 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.08 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|