C34H40ClNO8 — CID 131720338
4-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 131720338) has the molecular formula C34H40ClNO8 and a molecular weight of 626.15 g/mol. Its IUPAC name is 4-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 4-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 131720338 |
| Molecular Formula | C34H40ClNO8 |
| Molecular Weight | 626.15 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | 4-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CC)CCCCOc1ccc(C(=C(Cl)c2ccccc2)c2ccccc2)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H32ClNO.C6H8O7/c1-3-30(4-2)21-11-12-22-31-26-19-17-24(18-20-26)27(23-13-7-5-8-14-23)28(29)25-15-9-6-10-16-25;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-10,13-20H,3-4,11-12,21-22H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | AMKGTHFGXVUJGG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.15 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|