C25H24Cl2O — CID 21469834
1-[(Z)-2-chloro-1,2-diphenylethenyl]-4-(5-chloropentoxy)benzene (PubChem CID 21469834) has the molecular formula C25H24Cl2O and a molecular weight of 411.37 g/mol. Its IUPAC name is 1-[(Z)-2-chloro-1,2-diphenylethenyl]-4-(5-chloropentoxy)benzene.
| Compound Name | 1-[(Z)-2-chloro-1,2-diphenylethenyl]-4-(5-chloropentoxy)benzene |
|---|---|
| PubChem CID | 21469834 |
| Molecular Formula | C25H24Cl2O |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[(Z)-2-chloro-1,2-diphenylethenyl]-4-(5-chloropentoxy)benzene |
| SMILES | ClCCCCCOc1ccc(/C(=C(\Cl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24Cl2O/c26-18-8-3-9-19-28-23-16-14-21(15-17-23)24(20-10-4-1-5-11-20)25(27)22-12-6-2-7-13-22/h1-2,4-7,10-17H,3,8-9,18-19H2/b25-24- |
| InChIKey | HYHVMUHUVKYCMG-IZHYLOQSSA-N |
| XLogP | 7.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|