C22H18Cl2O — CID 164901767
1-[(E)-2-chloro-1,2-diphenylethenyl]-4-(2-chloroethoxy)benzene (PubChem CID 164901767) has the molecular formula C22H18Cl2O and a molecular weight of 369.29 g/mol. Its IUPAC name is 1-[(E)-2-chloro-1,2-diphenylethenyl]-4-(2-chloroethoxy)benzene.
| Compound Name | 1-[(E)-2-chloro-1,2-diphenylethenyl]-4-(2-chloroethoxy)benzene |
|---|---|
| PubChem CID | 164901767 |
| Molecular Formula | C22H18Cl2O |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-[(E)-2-chloro-1,2-diphenylethenyl]-4-(2-chloroethoxy)benzene |
| SMILES | ClCCOc1ccc(/C(=C(/Cl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18Cl2O/c23-15-16-25-20-13-11-18(12-14-20)21(17-7-3-1-4-8-17)22(24)19-9-5-2-6-10-19/h1-14H,15-16H2/b22-21+ |
| InChIKey | UWRMGGWAVBMGAW-QURGRASLSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|