C22H22ClN3OY-2 — CID 164901741
aminoazanide;2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]ethylazanide;yttrium (PubChem CID 164901741) has the molecular formula C22H22ClN3OY-2 and a molecular weight of 468.80 g/mol. Its IUPAC name is aminoazanide;2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]ethylazanide;yttrium.
| Compound Name | aminoazanide;2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]ethylazanide;yttrium |
|---|---|
| PubChem CID | 164901741 |
| Molecular Formula | C22H22ClN3OY-2 |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | aminoazanide;2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]ethylazanide;yttrium |
| SMILES | [NH-]CCOc1ccc(/C(=C(/Cl)c2ccccc2)c2ccccc2)cc1.[NH-]N.[Y] |
| InChI | InChI=1S/C22H19ClNO.H3N2.Y/c23-22(19-9-5-2-6-10-19)21(17-7-3-1-4-8-17)18-11-13-20(14-12-18)25-16-15-24;1-2;/h1-14,24H,15-16H2;1H,2H2;/q2*-1;/b22-21+;; |
| InChIKey | RFEOFRRDJZAFLD-ZPZFBZIMSA-N |
| XLogP | 6.18 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|