C28H42N2O2 — CID 3038049
2-[4-[(E)-3-[4-[2-(diethylamino)ethoxy]phenyl]but-2-en-2-yl]phenoxy]-N,N-diethylethanamine (PubChem CID 3038049) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 2-[4-[(E)-3-[4-[2-(diethylamino)ethoxy]phenyl]but-2-en-2-yl]phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-[(E)-3-[4-[2-(diethylamino)ethoxy]phenyl]but-2-en-2-yl]phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 3038049 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 2-[4-[(E)-3-[4-[2-(diethylamino)ethoxy]phenyl]but-2-en-2-yl]phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(/C(C)=C(\C)c2ccc(OCCN(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C28H42N2O2/c1-7-29(8-2)19-21-31-27-15-11-25(12-16-27)23(5)24(6)26-13-17-28(18-14-26)32-22-20-30(9-3)10-4/h11-18H,7-10,19-22H2,1-6H3/b24-23+ |
| InChIKey | CCPKNXRQRGVAMI-WCWDXBQESA-N |
| XLogP | 6.08 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|