C22H29NO2 — CID 6913690
N,N-diethyl-2-[4-[(E)-1-(4-methoxyphenyl)prop-1-en-2-yl]phenoxy]ethanamine (PubChem CID 6913690) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[(E)-1-(4-methoxyphenyl)prop-1-en-2-yl]phenoxy]ethanamine.
| Compound Name | N,N-diethyl-2-[4-[(E)-1-(4-methoxyphenyl)prop-1-en-2-yl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 6913690 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N,N-diethyl-2-[4-[(E)-1-(4-methoxyphenyl)prop-1-en-2-yl]phenoxy]ethanamine |
| SMILES | CCN(CC)CCOc1ccc(/C(C)=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-5-23(6-2)15-16-25-22-13-9-20(10-14-22)18(3)17-19-7-11-21(24-4)12-8-19/h7-14,17H,5-6,15-16H2,1-4H3/b18-17+ |
| InChIKey | UINFNQZMMNSFER-ISLYRVAYSA-N |
| XLogP | 4.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|