C25H34ClN3O — CID 54603588
(Z)-3-[4-[2-(diethylamino)ethoxy]phenyl]-2-[4-(diethylamino)phenyl]prop-2-enenitrile;hydrochloride (PubChem CID 54603588) has the molecular formula C25H34ClN3O and a molecular weight of 428.02 g/mol. Its IUPAC name is (Z)-3-[4-[2-(diethylamino)ethoxy]phenyl]-2-[4-(diethylamino)phenyl]prop-2-enenitrile;hydrochloride.
| Compound Name | (Z)-3-[4-[2-(diethylamino)ethoxy]phenyl]-2-[4-(diethylamino)phenyl]prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 54603588 |
| Molecular Formula | C25H34ClN3O |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | (Z)-3-[4-[2-(diethylamino)ethoxy]phenyl]-2-[4-(diethylamino)phenyl]prop-2-enenitrile;hydrochloride |
| SMILES | CCN(CC)CCOc1ccc(/C=C(\C#N)c2ccc(N(CC)CC)cc2)cc1.Cl |
| InChI | InChI=1S/C25H33N3O.ClH/c1-5-27(6-2)17-18-29-25-15-9-21(10-16-25)19-23(20-26)22-11-13-24(14-12-22)28(7-3)8-4;/h9-16,19H,5-8,17-18H2,1-4H3;1H/b23-19+; |
| InChIKey | MZOBRFAARMHEKP-IMPZXOFZSA-N |
| XLogP | 5.74 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|