C20H22N2 — CID 91740452
(Z)-3-[4-(diethylamino)phenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 91740452) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (Z)-3-[4-(diethylamino)phenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(diethylamino)phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 91740452 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (Z)-3-[4-(diethylamino)phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | CCN(CC)c1ccc(/C=C(\C#N)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H22N2/c1-4-22(5-2)20-12-8-17(9-13-20)14-19(15-21)18-10-6-16(3)7-11-18/h6-14H,4-5H2,1-3H3/b19-14+ |
| InChIKey | MLVOHPFQSNGDMA-XMHGGMMESA-N |
| XLogP | 4.91 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|