C33H35N3 — CID 158938003
(Z)-3-[4-(dibutylamino)phenyl]-2-[4-[(Z)-1-isocyano-2-(4-methylphenyl)ethenyl]phenyl]prop-2-enenitrile (PubChem CID 158938003) has the molecular formula C33H35N3 and a molecular weight of 473.66 g/mol. Its IUPAC name is (Z)-3-[4-(dibutylamino)phenyl]-2-[4-[(Z)-1-isocyano-2-(4-methylphenyl)ethenyl]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(dibutylamino)phenyl]-2-[4-[(Z)-1-isocyano-2-(4-methylphenyl)ethenyl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 158938003 |
| Molecular Formula | C33H35N3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (Z)-3-[4-(dibutylamino)phenyl]-2-[4-[(Z)-1-isocyano-2-(4-methylphenyl)ethenyl]phenyl]prop-2-enenitrile |
| SMILES | [C-]#[N+]/C(=C\c1ccc(C)cc1)c1ccc(/C(C#N)=C/c2ccc(N(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C33H35N3/c1-5-7-21-36(22-8-6-2)32-19-13-27(14-20-32)23-31(25-34)29-15-17-30(18-16-29)33(35-4)24-28-11-9-26(3)10-12-28/h9-20,23-24H,5-8,21-22H2,1-3H3/b31-23+,33-24- |
| InChIKey | UZHRTDNOBJZHMX-FRLFPXTKSA-N |
| XLogP | 8.88 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|