C26H35N3O3S — CID 10276881
4-[4-[(Z)-1-cyano-2-[4-(dibutylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate (PubChem CID 10276881) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is 4-[4-[(Z)-1-cyano-2-[4-(dibutylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[4-[(Z)-1-cyano-2-[4-(dibutylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 10276881 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 4-[4-[(Z)-1-cyano-2-[4-(dibutylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CCCCN(CCCC)c1ccc(/C=C(\C#N)c2cc[n+](CCCCS(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H35N3O3S/c1-3-5-16-29(17-6-4-2)26-11-9-23(10-12-26)21-25(22-27)24-13-18-28(19-14-24)15-7-8-20-33(30,31)32/h9-14,18-19,21H,3-8,15-17,20H2,1-2H3 |
| InChIKey | NNIXTSYRDOSOMI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|