C36H29N5+2 — CID 177405596
(E)-3-[4-(N-[4-[(Z)-2-cyano-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]anilino)phenyl]-2-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile (PubChem CID 177405596) has the molecular formula C36H29N5+2 and a molecular weight of 531.66 g/mol. Its IUPAC name is (E)-3-[4-(N-[4-[(Z)-2-cyano-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]anilino)phenyl]-2-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-(N-[4-[(Z)-2-cyano-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]anilino)phenyl]-2-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 177405596 |
| Molecular Formula | C36H29N5+2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | (E)-3-[4-(N-[4-[(Z)-2-cyano-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]anilino)phenyl]-2-(1-methylpyridin-1-ium-4-yl)prop-2-enenitrile |
| SMILES | C[n+]1ccc(/C(C#N)=C/c2ccc(N(c3ccccc3)c3ccc(/C=C(/C#N)c4cc[n+](C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H29N5/c1-39-20-16-30(17-21-39)32(26-37)24-28-8-12-35(13-9-28)41(34-6-4-3-5-7-34)36-14-10-29(11-15-36)25-33(27-38)31-18-22-40(2)23-19-31/h3-25H,1-2H3/q+2 |
| InChIKey | VBTHGKSQLRGDCR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 58.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|