C29H18N4 — CID 163977129
2-[(Z)-1-cyano-2-[4-(N-phenylanilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile (PubChem CID 163977129) has the molecular formula C29H18N4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[(Z)-1-cyano-2-[4-(N-phenylanilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile.
| Compound Name | 2-[(Z)-1-cyano-2-[4-(N-phenylanilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 163977129 |
| Molecular Formula | C29H18N4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[(Z)-1-cyano-2-[4-(N-phenylanilino)phenyl]ethenyl]benzene-1,4-dicarbonitrile |
| SMILES | N#C/C(=C\c1ccc(N(c2ccccc2)c2ccccc2)cc1)c1cc(C#N)ccc1C#N |
| InChI | InChI=1S/C29H18N4/c30-19-23-11-14-24(20-31)29(18-23)25(21-32)17-22-12-15-28(16-13-22)33(26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-18H/b25-17+ |
| InChIKey | SVDUEPCLLCPFRA-KOEQRZSOSA-N |
| XLogP | 6.96 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|