C54H50N4O4S2 — CID 139204005
(Z)-2-[4-[(Z)-1-cyano-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(N-(4-methoxyphenyl)anilino)phenyl]prop-2-enenitrile;methylsulfinylmethane (PubChem CID 139204005) has the molecular formula C54H50N4O4S2 and a molecular weight of 883.15 g/mol. Its IUPAC name is (Z)-2-[4-[(Z)-1-cyano-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(N-(4-methoxyphenyl)anilino)phenyl]prop-2-enenitrile;methylsulfinylmethane.
| Compound Name | (Z)-2-[4-[(Z)-1-cyano-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(N-(4-methoxyphenyl)anilino)phenyl]prop-2-enenitrile;methylsulfinylmethane |
|---|---|
| PubChem CID | 139204005 |
| Molecular Formula | C54H50N4O4S2 |
| Molecular Weight | 883.15 g/mol |
| Exact Mass | 882.33 |
| IUPAC Name | (Z)-2-[4-[(Z)-1-cyano-2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(N-(4-methoxyphenyl)anilino)phenyl]prop-2-enenitrile;methylsulfinylmethane |
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(/C=C(\C#N)c3ccc(/C(C#N)=C/c4ccc(N(c5ccccc5)c5ccc(OC)cc5)cc4)cc3)cc2)cc1.CS(C)=O.CS(C)=O |
| InChI | InChI=1S/C50H38N4O2.2C2H6OS/c1-55-49-29-25-47(26-30-49)53(43-9-5-3-6-10-43)45-21-13-37(14-22-45)33-41(35-51)39-17-19-40(20-18-39)42(36-52)34-38-15-23-46(24-16-38)54(44-11-7-4-8-12-44)48-27-31-50(56-2)32-28-48;2*1-4(2)3/h3-34H,1-2H3;2*1-2H3/b41-33+,42-34+;; |
| InChIKey | SGSYPKGSJWTZCL-OVOIYHGQSA-N |
| XLogP | 12.76 |
| TPSA | 106.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.15 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|