C52H42N4 — CID 154730336
2-[4-[1-cyano-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile (PubChem CID 154730336) has the molecular formula C52H42N4 and a molecular weight of 722.94 g/mol. Its IUPAC name is 2-[4-[1-cyano-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile.
| Compound Name | 2-[4-[1-cyano-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 154730336 |
| Molecular Formula | C52H42N4 |
| Molecular Weight | 722.94 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | 2-[4-[1-cyano-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]-3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]prop-2-enenitrile |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=C(C#N)c3ccc(C(C#N)=Cc4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H42N4/c1-37-5-21-47(22-6-37)55(48-23-7-38(2)8-24-48)51-29-13-41(14-30-51)33-45(35-53)43-17-19-44(20-18-43)46(36-54)34-42-15-31-52(32-16-42)56(49-25-9-39(3)10-26-49)50-27-11-40(4)12-28-50/h5-34H,1-4H3 |
| InChIKey | APGUDAMADYJMNC-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.94 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|