C36H33N — CID 22899856
N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 22899856) has the molecular formula C36H33N and a molecular weight of 479.67 g/mol. Its IUPAC name is N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 22899856 |
| Molecular Formula | C36H33N |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(C(=Cc2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H33N/c1-26-5-15-31(16-6-26)36(32-17-7-27(2)8-18-32)25-30-13-23-35(24-14-30)37(33-19-9-28(3)10-20-33)34-21-11-29(4)12-22-34/h5-25H,1-4H3 |
| InChIKey | IBPHREIZUGTJKC-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|