C37H31NO2 — CID 123770908
3-[4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]prop-2-enoic acid (PubChem CID 123770908) has the molecular formula C37H31NO2 and a molecular weight of 521.66 g/mol. Its IUPAC name is 3-[4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123770908 |
| Molecular Formula | C37H31NO2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 3-[4-(N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino)phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(C(=Cc2ccc(N(c3ccccc3)c3ccc(C=CC(=O)O)cc3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H31NO2/c1-27-8-17-31(18-9-27)36(32-19-10-28(2)11-20-32)26-30-14-23-35(24-15-30)38(33-6-4-3-5-7-33)34-21-12-29(13-22-34)16-25-37(39)40/h3-26H,1-2H3,(H,39,40) |
| InChIKey | JOAVIZXVZRLUTJ-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|