C35H31N — CID 58841601
4-methyl-N-(4-methylphenyl)-N-[4-[(E)-2-(4-methylphenyl)-1-phenylethenyl]phenyl]aniline (PubChem CID 58841601) has the molecular formula C35H31N and a molecular weight of 465.64 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-N-[4-[(E)-2-(4-methylphenyl)-1-phenylethenyl]phenyl]aniline.
| Compound Name | 4-methyl-N-(4-methylphenyl)-N-[4-[(E)-2-(4-methylphenyl)-1-phenylethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 58841601 |
| Molecular Formula | C35H31N |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-N-[4-[(E)-2-(4-methylphenyl)-1-phenylethenyl]phenyl]aniline |
| SMILES | Cc1ccc(/C=C(\c2ccccc2)c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H31N/c1-26-9-15-29(16-10-26)25-35(30-7-5-4-6-8-30)31-17-23-34(24-18-31)36(32-19-11-27(2)12-20-32)33-21-13-28(3)14-22-33/h4-25H,1-3H3/b35-25+ |
| InChIKey | FIZUOBZRNJCGBK-KVQDIILNSA-N |
| XLogP | 9.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|