C34H27Cl2N — CID 71096918
N-[4-[2,2-bis(4-chlorophenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 71096918) has the molecular formula C34H27Cl2N and a molecular weight of 520.50 g/mol. Its IUPAC name is N-[4-[2,2-bis(4-chlorophenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[2,2-bis(4-chlorophenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 71096918 |
| Molecular Formula | C34H27Cl2N |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N-[4-[2,2-bis(4-chlorophenyl)ethenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H27Cl2N/c1-24-3-17-31(18-4-24)37(32-19-5-25(2)6-20-32)33-21-7-26(8-22-33)23-34(27-9-13-29(35)14-10-27)28-11-15-30(36)16-12-28/h3-23H,1-2H3 |
| InChIKey | XIPASARHXMVNII-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|