C40H37NO4 — CID 59801352
[4-[4-(acetyloxymethyl)-N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino]phenyl]methyl acetate (PubChem CID 59801352) has the molecular formula C40H37NO4 and a molecular weight of 595.74 g/mol. Its IUPAC name is [4-[4-(acetyloxymethyl)-N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino]phenyl]methyl acetate.
| Compound Name | [4-[4-(acetyloxymethyl)-N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 59801352 |
| Molecular Formula | C40H37NO4 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | [4-[4-(acetyloxymethyl)-N-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]anilino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(N(c2ccc(C=C(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(COC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C40H37NO4/c1-28-5-15-35(16-6-28)40(36-17-7-29(2)8-18-36)25-32-9-19-37(20-10-32)41(38-21-11-33(12-22-38)26-44-30(3)42)39-23-13-34(14-24-39)27-45-31(4)43/h5-25H,26-27H2,1-4H3 |
| InChIKey | PKNJRBNXXLBMLF-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|