C44H45NO6 — CID 59061609
6-[4-[(Z)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]carbonyloxyhexyl acetate (PubChem CID 59061609) has the molecular formula C44H45NO6 and a molecular weight of 683.84 g/mol. Its IUPAC name is 6-[4-[(Z)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]carbonyloxyhexyl acetate.
| Compound Name | 6-[4-[(Z)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]carbonyloxyhexyl acetate |
|---|---|
| PubChem CID | 59061609 |
| Molecular Formula | C44H45NO6 |
| Molecular Weight | 683.84 g/mol |
| Exact Mass | 683.32 |
| IUPAC Name | 6-[4-[(Z)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]carbonyloxyhexyl acetate |
| SMILES | COc1ccc(/C(=C/c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(OC(=O)OCCCCCCOC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C44H45NO6/c1-32-9-19-38(20-10-32)45(39-21-11-33(2)12-22-39)40-23-13-35(14-24-40)31-43(36-15-25-41(48-4)26-16-36)37-17-27-42(28-18-37)51-44(47)50-30-8-6-5-7-29-49-34(3)46/h9-28,31H,5-8,29-30H2,1-4H3/b43-31- |
| InChIKey | KKNKYIVIMXGCNJ-SIFGHBQMSA-N |
| XLogP | 11.01 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.84 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|