C34H31NO6 — CID 54408302
2-[4-[2-(9-ethylcarbazol-3-yl)-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyethyl acetate (PubChem CID 54408302) has the molecular formula C34H31NO6 and a molecular weight of 549.62 g/mol. Its IUPAC name is 2-[4-[2-(9-ethylcarbazol-3-yl)-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyethyl acetate.
| Compound Name | 2-[4-[2-(9-ethylcarbazol-3-yl)-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyethyl acetate |
|---|---|
| PubChem CID | 54408302 |
| Molecular Formula | C34H31NO6 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 2-[4-[2-(9-ethylcarbazol-3-yl)-1-(4-methoxyphenyl)ethenyl]phenoxy]carbonyloxyethyl acetate |
| SMILES | CCn1c2ccccc2c2cc(C=C(c3ccc(OC)cc3)c3ccc(OC(=O)OCCOC(C)=O)cc3)ccc21 |
| InChI | InChI=1S/C34H31NO6/c1-4-35-32-8-6-5-7-29(32)31-22-24(9-18-33(31)35)21-30(25-10-14-27(38-3)15-11-25)26-12-16-28(17-13-26)41-34(37)40-20-19-39-23(2)36/h5-18,21-22H,4,19-20H2,1-3H3 |
| InChIKey | VSHUFIGGOFSXNP-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|