C26H23NO3 — CID 89057721
(1E,4E)-1-(9-ethylcarbazol-3-yl)-5-(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one (PubChem CID 89057721) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is (1E,4E)-1-(9-ethylcarbazol-3-yl)-5-(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(9-ethylcarbazol-3-yl)-5-(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 89057721 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (1E,4E)-1-(9-ethylcarbazol-3-yl)-5-(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES | CCn1c2ccccc2c2cc(/C=C/C(=O)/C=C/c3ccc(O)c(OC)c3)ccc21 |
| InChI | InChI=1S/C26H23NO3/c1-3-27-23-7-5-4-6-21(23)22-16-18(10-14-24(22)27)8-12-20(28)13-9-19-11-15-25(29)26(17-19)30-2/h4-17,29H,3H2,1-2H3/b12-8+,13-9+ |
| InChIKey | UXYREVDXKCXIPF-QHKWOANTSA-N |
| XLogP | 5.82 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|