C28H29NO2 — CID 141206117
4-[(1E,6E)-7-(9-ethylcarbazol-3-yl)hepta-1,6-dienyl]-2-methoxyphenol (PubChem CID 141206117) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[(1E,6E)-7-(9-ethylcarbazol-3-yl)hepta-1,6-dienyl]-2-methoxyphenol.
| Compound Name | 4-[(1E,6E)-7-(9-ethylcarbazol-3-yl)hepta-1,6-dienyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 141206117 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-[(1E,6E)-7-(9-ethylcarbazol-3-yl)hepta-1,6-dienyl]-2-methoxyphenol |
| SMILES | CCn1c2ccccc2c2cc(/C=C/CCC/C=C/c3ccc(O)c(OC)c3)ccc21 |
| InChI | InChI=1S/C28H29NO2/c1-3-29-25-14-10-9-13-23(25)24-19-21(15-17-26(24)29)11-7-5-4-6-8-12-22-16-18-27(30)28(20-22)31-2/h7-20,30H,3-6H2,1-2H3/b11-7+,12-8+ |
| InChIKey | HMEZLGHUNGXTSO-MKICQXMISA-N |
| XLogP | 7.43 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|