C21H14N4 — CID 171377802
(3E)-4-(9-ethylcarbazol-3-yl)buta-1,3-diene-1,1,2-tricarbonitrile (PubChem CID 171377802) has the molecular formula C21H14N4 and a molecular weight of 322.37 g/mol. Its IUPAC name is (3E)-4-(9-ethylcarbazol-3-yl)buta-1,3-diene-1,1,2-tricarbonitrile.
| Compound Name | (3E)-4-(9-ethylcarbazol-3-yl)buta-1,3-diene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 171377802 |
| Molecular Formula | C21H14N4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (3E)-4-(9-ethylcarbazol-3-yl)buta-1,3-diene-1,1,2-tricarbonitrile |
| SMILES | CCn1c2ccccc2c2cc(/C=C/C(C#N)=C(C#N)C#N)ccc21 |
| InChI | InChI=1S/C21H14N4/c1-2-25-20-6-4-3-5-18(20)19-11-15(8-10-21(19)25)7-9-16(12-22)17(13-23)14-24/h3-11H,2H2,1H3/b9-7+ |
| InChIKey | PYCWEYVBHNJWIA-VQHVLOKHSA-N |
| XLogP | 4.69 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|