C18H15N3S — CID 101167613
(E)-2-cyano-3-(9-ethylcarbazol-3-yl)prop-2-enethioamide (PubChem CID 101167613) has the molecular formula C18H15N3S and a molecular weight of 305.41 g/mol. Its IUPAC name is (E)-2-cyano-3-(9-ethylcarbazol-3-yl)prop-2-enethioamide.
| Compound Name | (E)-2-cyano-3-(9-ethylcarbazol-3-yl)prop-2-enethioamide |
|---|---|
| PubChem CID | 101167613 |
| Molecular Formula | C18H15N3S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (E)-2-cyano-3-(9-ethylcarbazol-3-yl)prop-2-enethioamide |
| SMILES | CCn1c2ccccc2c2cc(/C=C(\C#N)C(N)=S)ccc21 |
| InChI | InChI=1S/C18H15N3S/c1-2-21-16-6-4-3-5-14(16)15-10-12(7-8-17(15)21)9-13(11-19)18(20)22/h3-10H,2H2,1H3,(H2,20,22)/b13-9+ |
| InChIKey | FZRIEBKAYQIEOT-UKTHLTGXSA-N |
| XLogP | 4.01 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|