C30H33N3O4Si — CID 90444285
(E)-2-cyano-3-(9-ethylcarbazol-3-yl)-N-(4-triethoxysilylphenyl)prop-2-enamide (PubChem CID 90444285) has the molecular formula C30H33N3O4Si and a molecular weight of 527.70 g/mol. Its IUPAC name is (E)-2-cyano-3-(9-ethylcarbazol-3-yl)-N-(4-triethoxysilylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(9-ethylcarbazol-3-yl)-N-(4-triethoxysilylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90444285 |
| Molecular Formula | C30H33N3O4Si |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (E)-2-cyano-3-(9-ethylcarbazol-3-yl)-N-(4-triethoxysilylphenyl)prop-2-enamide |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(NC(=O)/C(C#N)=C/c2ccc3c(c2)c2ccccc2n3CC)cc1 |
| InChI | InChI=1S/C30H33N3O4Si/c1-5-33-28-12-10-9-11-26(28)27-20-22(13-18-29(27)33)19-23(21-31)30(34)32-24-14-16-25(17-15-24)38(35-6-2,36-7-3)37-8-4/h9-20H,5-8H2,1-4H3,(H,32,34)/b23-19+ |
| InChIKey | NNPQZYSHKRSVBA-FCDQGJHFSA-N |
| XLogP | 5.62 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|