C21H22N4O — CID 126385982
(E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1-ethyl-2-methylindol-3-yl)prop-2-enamide (PubChem CID 126385982) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1-ethyl-2-methylindol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1-ethyl-2-methylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126385982 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(1-ethyl-2-methylindol-3-yl)prop-2-enamide |
| SMILES | CCn1c(C)c(/C=C(\C#N)C(=O)Nn2c(C)ccc2C)c2ccccc21 |
| InChI | InChI=1S/C21H22N4O/c1-5-24-16(4)19(18-8-6-7-9-20(18)24)12-17(13-22)21(26)23-25-14(2)10-11-15(25)3/h6-12H,5H2,1-4H3,(H,23,26)/b17-12+ |
| InChIKey | UALGGBICMGFYFP-SFQUDFHCSA-N |
| XLogP | 4.07 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|