C25H21FN4O — CID 126386716
(E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide (PubChem CID 126386716) has the molecular formula C25H21FN4O and a molecular weight of 412.47 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126386716 |
| Molecular Formula | C25H21FN4O |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (E)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(C)n1NC(=O)/C(C#N)=C/c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H21FN4O/c1-17-7-8-18(2)30(17)28-25(31)20(14-27)13-21-16-29(24-6-4-3-5-23(21)24)15-19-9-11-22(26)12-10-19/h3-13,16H,15H2,1-2H3,(H,28,31)/b20-13+ |
| InChIKey | YMNOWJVOQNNQJH-DEDYPNTBSA-N |
| XLogP | 4.92 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|