C19H14FN3O — CID 6117816
(E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide (PubChem CID 6117816) has the molecular formula C19H14FN3O and a molecular weight of 319.34 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6117816 |
| Molecular Formula | C19H14FN3O |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (E)-2-cyano-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(Cc2ccc(F)cc2)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C19H14FN3O/c20-16-7-5-13(6-8-16)11-23-12-15(9-14(10-21)19(22)24)17-3-1-2-4-18(17)23/h1-9,12H,11H2,(H2,22,24)/b14-9+ |
| InChIKey | YVXTZIBVGNMKFW-NTEUORMPSA-N |
| XLogP | 3.22 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|