C20H15FN4OS — CID 2983602
2-[3-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)indol-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 2983602) has the molecular formula C20H15FN4OS and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[3-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)indol-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)indol-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2983602 |
| Molecular Formula | C20H15FN4OS |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-[3-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)indol-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | N#CC(=Cc1cn(CC(=O)Nc2ccc(F)cc2)c2ccccc12)C(N)=S |
| InChI | InChI=1S/C20H15FN4OS/c21-15-5-7-16(8-6-15)24-19(26)12-25-11-14(9-13(10-22)20(23)27)17-3-1-2-4-18(17)25/h1-9,11H,12H2,(H2,23,27)(H,24,26) |
| InChIKey | AMQFQFSBANWLLB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|