C28H22N4O4 — CID 3612711
3-[[2-cyano-3-[1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]prop-2-enoyl]amino]benzoic acid (PubChem CID 3612711) has the molecular formula C28H22N4O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is 3-[[2-cyano-3-[1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[2-cyano-3-[1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3612711 |
| Molecular Formula | C28H22N4O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 3-[[2-cyano-3-[1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1ccc(NC(=O)Cn2cc(C=C(C#N)C(=O)Nc3cccc(C(=O)O)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H22N4O4/c1-18-9-11-22(12-10-18)30-26(33)17-32-16-21(24-7-2-3-8-25(24)32)13-20(15-29)27(34)31-23-6-4-5-19(14-23)28(35)36/h2-14,16H,17H2,1H3,(H,30,33)(H,31,34)(H,35,36) |
| InChIKey | NSAPLUGKQCHGMW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|