C21H16BrN3O3 — CID 11546633
2-[3-[(E)-3-(3-bromo-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 11546633) has the molecular formula C21H16BrN3O3 and a molecular weight of 438.28 g/mol. Its IUPAC name is 2-[3-[(E)-3-(3-bromo-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-3-(3-bromo-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11546633 |
| Molecular Formula | C21H16BrN3O3 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-[3-[(E)-3-(3-bromo-4-methylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cn(CC(=O)O)c3ccccc23)cc1Br |
| InChI | InChI=1S/C21H16BrN3O3/c1-13-6-7-16(9-18(13)22)24-21(28)14(10-23)8-15-11-25(12-20(26)27)19-5-3-2-4-17(15)19/h2-9,11H,12H2,1H3,(H,24,28)(H,26,27)/b14-8+ |
| InChIKey | WZIYAAGPOBWBTH-RIYZIHGNSA-N |
| XLogP | 4.34 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|