C21H16N4O — CID 21212305
(E)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 21212305) has the molecular formula C21H16N4O and a molecular weight of 340.39 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21212305 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (E)-2-cyano-3-[1-(cyanomethyl)indol-3-yl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cn(CC#N)c3ccccc23)cc1 |
| InChI | InChI=1S/C21H16N4O/c1-15-6-8-18(9-7-15)24-21(26)16(13-23)12-17-14-25(11-10-22)20-5-3-2-4-19(17)20/h2-9,12,14H,11H2,1H3,(H,24,26)/b16-12+ |
| InChIKey | GKYGQLKTLHKTLB-FOWTUZBSSA-N |
| XLogP | 4.02 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|