C29H23FN4O2 — CID 3654678
N-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 3654678) has the molecular formula C29H23FN4O2 and a molecular weight of 478.53 g/mol. Its IUPAC name is N-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 3654678 |
| Molecular Formula | C29H23FN4O2 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NN=Cc1cn(CC(=O)Nc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C29H23FN4O2/c30-23-12-14-24(15-13-23)32-29(36)19-34-18-22(26-10-3-4-11-27(26)34)17-31-33-28(35)16-21-8-5-7-20-6-1-2-9-25(20)21/h1-15,17-18H,16,19H2,(H,32,36)(H,33,35) |
| InChIKey | VCWHFJCWIPEVOX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|