C27H24N4O2 — CID 3834315
N-[[1-(2-anilino-2-oxoethyl)indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 3834315) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[[1-(2-anilino-2-oxoethyl)indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[[1-(2-anilino-2-oxoethyl)indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3834315 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[[1-(2-anilino-2-oxoethyl)indol-3-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Cn1cc(C=NNC(=O)C2CC2c2ccccc2)c2ccccc21)Nc1ccccc1 |
| InChI | InChI=1S/C27H24N4O2/c32-26(29-21-11-5-2-6-12-21)18-31-17-20(22-13-7-8-14-25(22)31)16-28-30-27(33)24-15-23(24)19-9-3-1-4-10-19/h1-14,16-17,23-24H,15,18H2,(H,29,32)(H,30,33) |
| InChIKey | ATGGWOFHSASMKH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|