C26H21ClN4O3 — CID 3958131
N-(4-chlorophenyl)-2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]acetamide (PubChem CID 3958131) has the molecular formula C26H21ClN4O3 and a molecular weight of 472.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 3958131 |
| Molecular Formula | C26H21ClN4O3 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-(4-chlorophenyl)-2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)c2ccccc21)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21ClN4O3/c27-18-7-9-19(10-8-18)29-22(32)14-30-13-17(20-3-1-2-4-21(20)30)12-28-31-25(33)23-15-5-6-16(11-15)24(23)26(31)34/h1-10,12-13,15-16,23-24H,11,14H2,(H,29,32) |
| InChIKey | LCWZWVFXINUSRI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|