C34H24ClN3O2 — CID 124558969
(15S,19R)-17-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124558969) has the molecular formula C34H24ClN3O2 and a molecular weight of 542.04 g/mol. Its IUPAC name is (15S,19R)-17-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-17-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124558969 |
| Molecular Formula | C34H24ClN3O2 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (15S,19R)-17-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C(=O)N1/N=C\c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C34H24ClN3O2/c35-22-15-13-20(14-16-22)18-37-19-21(23-7-5-6-12-28(23)37)17-36-38-33(39)31-29-24-8-1-2-9-25(24)30(32(31)34(38)40)27-11-4-3-10-26(27)29/h1-17,19,29-32H,18H2/b36-17-/t29?,30?,31-,32+ |
| InChIKey | JZHPRJMRMRMLQI-GFPZGZMWSA-N |
| XLogP | 6.57 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|