C30H25N3O2 — CID 98101385
(1R,2S,6R,7R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 98101385) has the molecular formula C30H25N3O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98101385 |
| Molecular Formula | C30H25N3O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (1R,2S,6R,7R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1/N=C\c1cn(Cc3cccc4ccccc34)c3ccccc13)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C30H25N3O2/c34-29-27-20-12-13-21(15-14-20)28(27)30(35)33(29)31-16-23-18-32(26-11-4-3-10-25(23)26)17-22-8-5-7-19-6-1-2-9-24(19)22/h1-13,16,18,20-21,27-28H,14-15,17H2/b31-16-/t20-,21-,27-,28+/m0/s1 |
| InChIKey | RGZFREJEEMJRJV-IWSOFFFOSA-N |
| XLogP | 5.37 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|