C31H25N3O2 — CID 126184992
(1S,2S,6R,7S,8R,10R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 126184992) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is (1S,2S,6R,7S,8R,10R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7S,8R,10R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 126184992 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (1S,2S,6R,7S,8R,10R)-4-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@@H]2C(=O)N1/N=C\c1cn(Cc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C31H25N3O2/c35-30-28-23-12-13-24(26-14-25(23)26)29(28)31(36)34(30)32-15-20-17-33(27-11-4-3-10-22(20)27)16-19-8-5-7-18-6-1-2-9-21(18)19/h1-13,15,17,23-26,28-29H,14,16H2/b32-15-/t23-,24-,25-,26-,28-,29+/m0/s1 |
| InChIKey | MTTZOTPDYBXWHT-GDAUMLSISA-N |
| XLogP | 5.23 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|