C26H20N4O2 — CID 5017396
2-[[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]methyl]benzonitrile (PubChem CID 5017396) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 5017396 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)c2ccccc21 |
| InChI | InChI=1S/C26H20N4O2/c27-12-18-5-1-2-6-19(18)14-29-15-20(21-7-3-4-8-22(21)29)13-28-30-25(31)23-16-9-10-17(11-16)24(23)26(30)32/h1-10,13,15-17,23-24H,11,14H2 |
| InChIKey | GIYYCLPFHQQRRU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|