C25H20ClN3O2 — CID 22525385
(1S,2S,6R,7S)-4-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 22525385) has the molecular formula C25H20ClN3O2 and a molecular weight of 429.91 g/mol. Its IUPAC name is (1S,2S,6R,7S)-4-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7S)-4-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 22525385 |
| Molecular Formula | C25H20ClN3O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (1S,2S,6R,7S)-4-[(Z)-[1-[(2-chlorophenyl)methyl]indol-3-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1/N=C\c1cn(Cc3ccccc3Cl)c3ccccc13)[C@@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C25H20ClN3O2/c26-20-7-3-1-5-17(20)13-28-14-18(19-6-2-4-8-21(19)28)12-27-29-24(30)22-15-9-10-16(11-15)23(22)25(29)31/h1-10,12,14-16,22-23H,11,13H2/b27-12-/t15-,16-,22-,23+/m1/s1 |
| InChIKey | DAPMSDRZMYYKSJ-SPNLLSNYSA-N |
| XLogP | 4.48 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|