C26H21FN4O3 — CID 4001596
2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 4001596) has the molecular formula C26H21FN4O3 and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4001596 |
| Molecular Formula | C26H21FN4O3 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[3-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]indol-1-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cn1cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)c2ccccc21)Nc1cccc(F)c1 |
| InChI | InChI=1S/C26H21FN4O3/c27-18-4-3-5-19(11-18)29-22(32)14-30-13-17(20-6-1-2-7-21(20)30)12-28-31-25(33)23-15-8-9-16(10-15)24(23)26(31)34/h1-9,11-13,15-16,23-24H,10,14H2,(H,29,32) |
| InChIKey | OUFUKHNXHWGYHM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|