C24H19Cl2N3O4 — CID 126411408
2-[2,6-dichloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-phenylacetamide (PubChem CID 126411408) has the molecular formula C24H19Cl2N3O4 and a molecular weight of 484.34 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2,6-dichloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126411408 |
| Molecular Formula | C24H19Cl2N3O4 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 2-[2,6-dichloro-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1c(Cl)cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C24H19Cl2N3O4/c25-17-8-13(9-18(26)22(17)33-12-19(30)28-16-4-2-1-3-5-16)11-27-29-23(31)20-14-6-7-15(10-14)21(20)24(29)32/h1-9,11,14-15,20-21H,10,12H2,(H,28,30)/t14-,15-,20-,21+/m0/s1 |
| InChIKey | RZYZVOOBHJPDIQ-LATRNWQMSA-N |
| XLogP | 4.15 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|