C30H28N4O4 — CID 126411070
2-[4-[3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-phenylacetamide (PubChem CID 126411070) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 2-[4-[3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126411070 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 2-[4-[3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-phenylacetamide |
| SMILES | Cc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(C)n1-c1ccc(OCC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N4O4/c1-18-14-22(16-31-34-29(36)27-20-8-9-21(15-20)28(27)30(34)37)19(2)33(18)24-10-12-25(13-11-24)38-17-26(35)32-23-6-4-3-5-7-23/h3-14,16,20-21,27-28H,15,17H2,1-2H3,(H,32,35)/t20-,21-,27-,28+/m0/s1 |
| InChIKey | KQEZGFVKLUPKKD-XQOBHTRLSA-N |
| XLogP | 4.25 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|