C19H16Cl2N2O5 — CID 4299744
2-[2,6-dichloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoic acid (PubChem CID 4299744) has the molecular formula C19H16Cl2N2O5 and a molecular weight of 423.25 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoic acid.
| Compound Name | 2-[2,6-dichloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 4299744 |
| Molecular Formula | C19H16Cl2N2O5 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2-[2,6-dichloro-4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1c(Cl)cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C19H16Cl2N2O5/c1-8(19(26)27)28-16-12(20)4-9(5-13(16)21)7-22-23-17(24)14-10-2-3-11(6-10)15(14)18(23)25/h2-5,7-8,10-11,14-15H,6H2,1H3,(H,26,27) |
| InChIKey | LVZFITOALQRMIN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|