C19H18BrClN2O3 — CID 3975631
4-[(3-bromo-5-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 3975631) has the molecular formula C19H18BrClN2O3 and a molecular weight of 437.72 g/mol. Its IUPAC name is 4-[(3-bromo-5-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[(3-bromo-5-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3975631 |
| Molecular Formula | C19H18BrClN2O3 |
| Molecular Weight | 437.72 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 4-[(3-bromo-5-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(C)Oc1c(Cl)cc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1Br |
| InChI | InChI=1S/C19H18BrClN2O3/c1-9(2)26-17-13(20)5-10(6-14(17)21)8-22-23-18(24)15-11-3-4-12(7-11)16(15)19(23)25/h3-6,8-9,11-12,15-16H,7H2,1-2H3 |
| InChIKey | IHDLKHDSXQYXLR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|