C17H14Br2N2O3 — CID 126406166
(1R,2R,6S,7R)-4-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126406166) has the molecular formula C17H14Br2N2O3 and a molecular weight of 454.12 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126406166 |
| Molecular Formula | C17H14Br2N2O3 |
| Molecular Weight | 454.12 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | (1R,2R,6S,7R)-4-[(3,5-dibromo-4-methoxyphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1c(Br)cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc1Br |
| InChI | InChI=1S/C17H14Br2N2O3/c1-24-15-11(18)4-8(5-12(15)19)7-20-21-16(22)13-9-2-3-10(6-9)14(13)17(21)23/h2-5,7,9-10,13-14H,6H2,1H3/t9-,10-,13-,14+/m0/s1 |
| InChIKey | BOMUWHMGNFGRCG-TXFQPVFDSA-N |
| XLogP | 3.36 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.12 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|