C19H18BrN3O5 — CID 126406154
2-[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetamide (PubChem CID 126406154) has the molecular formula C19H18BrN3O5 and a molecular weight of 448.27 g/mol. Its IUPAC name is 2-[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126406154 |
| Molecular Formula | C19H18BrN3O5 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C19H18BrN3O5/c1-27-13-5-9(4-12(20)17(13)28-8-14(21)24)7-22-23-18(25)15-10-2-3-11(6-10)16(15)19(23)26/h2-5,7,10-11,15-16H,6,8H2,1H3,(H2,21,24)/t10-,11-,15-,16+/m0/s1 |
| InChIKey | BOAMBACTQGKLFV-KUDNYVPYSA-N |
| XLogP | 1.46 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|