C19H16ClN2O6- — CID 23375213
2-[2-chloro-4-[(Z)-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate (PubChem CID 23375213) has the molecular formula C19H16ClN2O6- and a molecular weight of 403.80 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate.
| Compound Name | 2-[2-chloro-4-[(Z)-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 23375213 |
| Molecular Formula | C19H16ClN2O6- |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-methoxyphenoxy]acetate |
| SMILES | COc1cc(/C=N\N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@@H]3C2)cc(Cl)c1OCC(=O)[O-] |
| InChI | InChI=1S/C19H17ClN2O6/c1-27-13-5-9(4-12(20)17(13)28-8-14(23)24)7-21-22-18(25)15-10-2-3-11(6-10)16(15)19(22)26/h2-5,7,10-11,15-16H,6,8H2,1H3,(H,23,24)/p-1/b21-7-/t10-,11-,15-,16+/m1/s1 |
| InChIKey | DEKOZJHYEARQFI-GIDWAPRZSA-M |
| XLogP | 0.62 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|